C13H18ClN3O2S — CID 106335391
2-[(6-chloro-1H-indol-3-yl)methylamino]-N,N-dimethylethanesulfonamide (PubChem CID 106335391) has the molecular formula C13H18ClN3O2S and a molecular weight of 315.83 g/mol. Its IUPAC name is 2-[(6-chloro-1H-indol-3-yl)methylamino]-N,N-dimethylethanesulfonamide.
| Compound Name | 2-[(6-chloro-1H-indol-3-yl)methylamino]-N,N-dimethylethanesulfonamide |
|---|---|
| PubChem CID | 106335391 |
| Molecular Formula | C13H18ClN3O2S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-[(6-chloro-1H-indol-3-yl)methylamino]-N,N-dimethylethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)CCNCc1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C13H18ClN3O2S/c1-17(2)20(18,19)6-5-15-8-10-9-16-13-7-11(14)3-4-12(10)13/h3-4,7,9,15-16H,5-6,8H2,1-2H3 |
| InChIKey | KKYNATUILQDLAJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|