C14H19ClN2O2 — CID 78974959
N-[(6-chloro-1H-indol-3-yl)methyl]-2-(2-methoxyethoxy)ethanamine (PubChem CID 78974959) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is N-[(6-chloro-1H-indol-3-yl)methyl]-2-(2-methoxyethoxy)ethanamine.
| Compound Name | N-[(6-chloro-1H-indol-3-yl)methyl]-2-(2-methoxyethoxy)ethanamine |
|---|---|
| PubChem CID | 78974959 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N-[(6-chloro-1H-indol-3-yl)methyl]-2-(2-methoxyethoxy)ethanamine |
| SMILES | COCCOCCNCc1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C14H19ClN2O2/c1-18-6-7-19-5-4-16-9-11-10-17-14-8-12(15)2-3-13(11)14/h2-3,8,10,16-17H,4-7,9H2,1H3 |
| InChIKey | PMGWKMIRHAGMEY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|