C11H15NO5 — CID 10633836
ethyl (4aS,5R,7aR)-5-methoxy-2-oxo-3,4a,5,7a-tetrahydrocyclopenta[b][1,4]oxazine-4-carboxylate (PubChem CID 10633836) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is ethyl (4aS,5R,7aR)-5-methoxy-2-oxo-3,4a,5,7a-tetrahydrocyclopenta[b][1,4]oxazine-4-carboxylate.
| Compound Name | ethyl (4aS,5R,7aR)-5-methoxy-2-oxo-3,4a,5,7a-tetrahydrocyclopenta[b][1,4]oxazine-4-carboxylate |
|---|---|
| PubChem CID | 10633836 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | ethyl (4aS,5R,7aR)-5-methoxy-2-oxo-3,4a,5,7a-tetrahydrocyclopenta[b][1,4]oxazine-4-carboxylate |
| SMILES | CCOC(=O)N1CC(=O)O[C@@H]2C=C[C@@H](OC)[C@@H]21 |
| InChI | InChI=1S/C11H15NO5/c1-3-16-11(14)12-6-9(13)17-8-5-4-7(15-2)10(8)12/h4-5,7-8,10H,3,6H2,1-2H3/t7-,8-,10+/m1/s1 |
| InChIKey | HHGKUSLECHYMAG-MRTMQBJTSA-N |
| XLogP | 0.32 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|