C10H18N6O2S — CID 106338980
N-[3-(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)propyl]methanesulfonamide (PubChem CID 106338980) has the molecular formula C10H18N6O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is N-[3-(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)propyl]methanesulfonamide.
| Compound Name | N-[3-(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106338980 |
| Molecular Formula | C10H18N6O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | N-[3-(5-amino-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl)propyl]methanesulfonamide |
| SMILES | Cc1nn(C)c2c1nc(N)n2CCCNS(C)(=O)=O |
| InChI | InChI=1S/C10H18N6O2S/c1-7-8-9(15(2)14-7)16(10(11)13-8)6-4-5-12-19(3,17)18/h12H,4-6H2,1-3H3,(H2,11,13) |
| InChIKey | YRPBJHXQGGCMKF-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|