C9H17N5O3S — CID 66120267
4-amino-N-[2-(methanesulfonamido)ethyl]-1,3-dimethylpyrazole-5-carboxamide (PubChem CID 66120267) has the molecular formula C9H17N5O3S and a molecular weight of 275.33 g/mol. Its IUPAC name is 4-amino-N-[2-(methanesulfonamido)ethyl]-1,3-dimethylpyrazole-5-carboxamide.
| Compound Name | 4-amino-N-[2-(methanesulfonamido)ethyl]-1,3-dimethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 66120267 |
| Molecular Formula | C9H17N5O3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 4-amino-N-[2-(methanesulfonamido)ethyl]-1,3-dimethylpyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C(=O)NCCNS(C)(=O)=O)c1N |
| InChI | InChI=1S/C9H17N5O3S/c1-6-7(10)8(14(2)13-6)9(15)11-4-5-12-18(3,16)17/h12H,4-5,10H2,1-3H3,(H,11,15) |
| InChIKey | DSUDXHKUJLKVIL-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|