C11H21N3O5S — CID 106340446
4-[2-(methylsulfamoyl)ethylcarbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 106340446) has the molecular formula C11H21N3O5S and a molecular weight of 307.37 g/mol. Its IUPAC name is 4-[2-(methylsulfamoyl)ethylcarbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[2-(methylsulfamoyl)ethylcarbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106340446 |
| Molecular Formula | C11H21N3O5S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-[2-(methylsulfamoyl)ethylcarbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | CNS(=O)(=O)CCNC(=O)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C11H21N3O5S/c1-12-20(18,19)7-6-13-11(17)14-9-4-2-8(3-5-9)10(15)16/h8-9,12H,2-7H2,1H3,(H,15,16)(H2,13,14,17) |
| InChIKey | TVFLOSFIDYLMNB-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |