C9H19N3O3S — CID 84523572
1-cyclopentyl-3-[2-(methylsulfamoyl)ethyl]urea (PubChem CID 84523572) has the molecular formula C9H19N3O3S and a molecular weight of 249.34 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-(methylsulfamoyl)ethyl]urea.
| Compound Name | 1-cyclopentyl-3-[2-(methylsulfamoyl)ethyl]urea |
|---|---|
| PubChem CID | 84523572 |
| Molecular Formula | C9H19N3O3S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 1-cyclopentyl-3-[2-(methylsulfamoyl)ethyl]urea |
| SMILES | CNS(=O)(=O)CCNC(=O)NC1CCCC1 |
| InChI | InChI=1S/C9H19N3O3S/c1-10-16(14,15)7-6-11-9(13)12-8-4-2-3-5-8/h8,10H,2-7H2,1H3,(H2,11,12,13) |
| InChIKey | QZDYOLQTOBKKIP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |