C9H19N3O5S — CID 106340724
3-methyl-4-[2-(methylsulfamoyl)ethylcarbamoylamino]butanoic acid (PubChem CID 106340724) has the molecular formula C9H19N3O5S and a molecular weight of 281.33 g/mol. Its IUPAC name is 3-methyl-4-[2-(methylsulfamoyl)ethylcarbamoylamino]butanoic acid.
| Compound Name | 3-methyl-4-[2-(methylsulfamoyl)ethylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 106340724 |
| Molecular Formula | C9H19N3O5S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3-methyl-4-[2-(methylsulfamoyl)ethylcarbamoylamino]butanoic acid |
| SMILES | CNS(=O)(=O)CCNC(=O)NCC(C)CC(=O)O |
| InChI | InChI=1S/C9H19N3O5S/c1-7(5-8(13)14)6-12-9(15)11-3-4-18(16,17)10-2/h7,10H,3-6H2,1-2H3,(H,13,14)(H2,11,12,15) |
| InChIKey | JFMVPNVIKFFGDU-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |