C17H14N2 — CID 10634173
2-phenanthren-9-yl-4,5-dihydro-1H-imidazole (PubChem CID 10634173) has the molecular formula C17H14N2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-phenanthren-9-yl-4,5-dihydro-1H-imidazole.
| Compound Name | 2-phenanthren-9-yl-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 10634173 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2-phenanthren-9-yl-4,5-dihydro-1H-imidazole |
| SMILES | c1ccc2c(c1)cc(C1=NCCN1)c1ccccc12 |
| InChI | InChI=1S/C17H14N2/c1-2-6-13-12(5-1)11-16(17-18-9-10-19-17)15-8-4-3-7-14(13)15/h1-8,11H,9-10H2,(H,18,19) |
| InChIKey | KSHHDMBEBWKJAO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|