C10H15ClN4O3S — CID 106342640
6-amino-3-chloro-N-[2-(ethylsulfamoyl)ethyl]pyridine-2-carboxamide (PubChem CID 106342640) has the molecular formula C10H15ClN4O3S and a molecular weight of 306.78 g/mol. Its IUPAC name is 6-amino-3-chloro-N-[2-(ethylsulfamoyl)ethyl]pyridine-2-carboxamide.
| Compound Name | 6-amino-3-chloro-N-[2-(ethylsulfamoyl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106342640 |
| Molecular Formula | C10H15ClN4O3S |
| Molecular Weight | 306.78 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 6-amino-3-chloro-N-[2-(ethylsulfamoyl)ethyl]pyridine-2-carboxamide |
| SMILES | CCNS(=O)(=O)CCNC(=O)c1nc(N)ccc1Cl |
| InChI | InChI=1S/C10H15ClN4O3S/c1-2-14-19(17,18)6-5-13-10(16)9-7(11)3-4-8(12)15-9/h3-4,14H,2,5-6H2,1H3,(H2,12,15)(H,13,16) |
| InChIKey | VORCBASMSVCQHL-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.78 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |