C10H13ClN4O2 — CID 55041650
6-amino-N-(4-amino-4-oxobutyl)-3-chloropyridine-2-carboxamide (PubChem CID 55041650) has the molecular formula C10H13ClN4O2 and a molecular weight of 256.69 g/mol. Its IUPAC name is 6-amino-N-(4-amino-4-oxobutyl)-3-chloropyridine-2-carboxamide.
| Compound Name | 6-amino-N-(4-amino-4-oxobutyl)-3-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 55041650 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 6-amino-N-(4-amino-4-oxobutyl)-3-chloropyridine-2-carboxamide |
| SMILES | NC(=O)CCCNC(=O)c1nc(N)ccc1Cl |
| InChI | InChI=1S/C10H13ClN4O2/c11-6-3-4-7(12)15-9(6)10(17)14-5-1-2-8(13)16/h3-4H,1-2,5H2,(H2,12,15)(H2,13,16)(H,14,17) |
| InChIKey | QZKLMSCHNJNWAJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|