C17H38N2 — CID 106345395
2-N-dodecyl-3-methylbutane-1,2-diamine (PubChem CID 106345395) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is 2-N-dodecyl-3-methylbutane-1,2-diamine.
| Compound Name | 2-N-dodecyl-3-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 106345395 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | 2-N-dodecyl-3-methylbutane-1,2-diamine |
| SMILES | CCCCCCCCCCCCNC(CN)C(C)C |
| InChI | InChI=1S/C17H38N2/c1-4-5-6-7-8-9-10-11-12-13-14-19-17(15-18)16(2)3/h16-17,19H,4-15,18H2,1-3H3 |
| InChIKey | WCNOKNSOBOBWLG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|