C8H13N5O3S — CID 106346366
2-[1-(1-amino-3-methyl-1-oxobutan-2-yl)tetrazol-5-yl]sulfanylacetic acid (PubChem CID 106346366) has the molecular formula C8H13N5O3S and a molecular weight of 259.29 g/mol. Its IUPAC name is 2-[1-(1-amino-3-methyl-1-oxobutan-2-yl)tetrazol-5-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(1-amino-3-methyl-1-oxobutan-2-yl)tetrazol-5-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 106346366 |
| Molecular Formula | C8H13N5O3S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-[1-(1-amino-3-methyl-1-oxobutan-2-yl)tetrazol-5-yl]sulfanylacetic acid |
| SMILES | CC(C)C(C(N)=O)n1nnnc1SCC(=O)O |
| InChI | InChI=1S/C8H13N5O3S/c1-4(2)6(7(9)16)13-8(10-11-12-13)17-3-5(14)15/h4,6H,3H2,1-2H3,(H2,9,16)(H,14,15) |
| InChIKey | KJHQVLPTROERDM-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |