C10H19N5O2S — CID 114139243
2-[1-[3-[methyl(propan-2-yl)amino]propyl]tetrazol-5-yl]sulfanylacetic acid (PubChem CID 114139243) has the molecular formula C10H19N5O2S and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-[1-[3-[methyl(propan-2-yl)amino]propyl]tetrazol-5-yl]sulfanylacetic acid.
| Compound Name | 2-[1-[3-[methyl(propan-2-yl)amino]propyl]tetrazol-5-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 114139243 |
| Molecular Formula | C10H19N5O2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-[1-[3-[methyl(propan-2-yl)amino]propyl]tetrazol-5-yl]sulfanylacetic acid |
| SMILES | CC(C)N(C)CCCn1nnnc1SCC(=O)O |
| InChI | InChI=1S/C10H19N5O2S/c1-8(2)14(3)5-4-6-15-10(11-12-13-15)18-7-9(16)17/h8H,4-7H2,1-3H3,(H,16,17) |
| InChIKey | DKSCFJAPHNRURH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |