C10H17N5O3S — CID 113411581
2-[1-[3-(diethylamino)-3-oxopropyl]tetrazol-5-yl]sulfanylacetic acid (PubChem CID 113411581) has the molecular formula C10H17N5O3S and a molecular weight of 287.35 g/mol. Its IUPAC name is 2-[1-[3-(diethylamino)-3-oxopropyl]tetrazol-5-yl]sulfanylacetic acid.
| Compound Name | 2-[1-[3-(diethylamino)-3-oxopropyl]tetrazol-5-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 113411581 |
| Molecular Formula | C10H17N5O3S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-[1-[3-(diethylamino)-3-oxopropyl]tetrazol-5-yl]sulfanylacetic acid |
| SMILES | CCN(CC)C(=O)CCn1nnnc1SCC(=O)O |
| InChI | InChI=1S/C10H17N5O3S/c1-3-14(4-2)8(16)5-6-15-10(11-12-13-15)19-7-9(17)18/h3-7H2,1-2H3,(H,17,18) |
| InChIKey | ZYWWOBSDSNPJDF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |