C8H15N5O3S — CID 70441241
[1-[3-(dimethylamino)propyl]tetrazol-5-yl]sulfanylmethyl hydrogen carbonate (PubChem CID 70441241) has the molecular formula C8H15N5O3S and a molecular weight of 261.31 g/mol. Its IUPAC name is [1-[3-(dimethylamino)propyl]tetrazol-5-yl]sulfanylmethyl hydrogen carbonate.
| Compound Name | [1-[3-(dimethylamino)propyl]tetrazol-5-yl]sulfanylmethyl hydrogen carbonate |
|---|---|
| PubChem CID | 70441241 |
| Molecular Formula | C8H15N5O3S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | [1-[3-(dimethylamino)propyl]tetrazol-5-yl]sulfanylmethyl hydrogen carbonate |
| SMILES | CN(C)CCCn1nnnc1SCOC(=O)O |
| InChI | InChI=1S/C8H15N5O3S/c1-12(2)4-3-5-13-7(9-10-11-13)17-6-16-8(14)15/h3-6H2,1-2H3,(H,14,15) |
| InChIKey | XTTQBDFONJCXOM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|