C7H15N5S2 — CID 146534310
N,N-dimethyl-2-[5-(methylsulfanylmethylsulfanyl)tetrazol-1-yl]ethanamine (PubChem CID 146534310) has the molecular formula C7H15N5S2 and a molecular weight of 233.37 g/mol. Its IUPAC name is N,N-dimethyl-2-[5-(methylsulfanylmethylsulfanyl)tetrazol-1-yl]ethanamine.
| Compound Name | N,N-dimethyl-2-[5-(methylsulfanylmethylsulfanyl)tetrazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 146534310 |
| Molecular Formula | C7H15N5S2 |
| Molecular Weight | 233.37 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | N,N-dimethyl-2-[5-(methylsulfanylmethylsulfanyl)tetrazol-1-yl]ethanamine |
| SMILES | CSCSc1nnnn1CCN(C)C |
| InChI | InChI=1S/C7H15N5S2/c1-11(2)4-5-12-7(8-9-10-12)14-6-13-3/h4-6H2,1-3H3 |
| InChIKey | OZGFWCLEFCZJIK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|