C14H19ClN6OS — CID 55836118
N-(3-chloro-2-methylphenyl)-2-[1-[2-(dimethylamino)ethyl]tetrazol-5-yl]sulfanylacetamide (PubChem CID 55836118) has the molecular formula C14H19ClN6OS and a molecular weight of 354.87 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-[1-[2-(dimethylamino)ethyl]tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-[1-[2-(dimethylamino)ethyl]tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 55836118 |
| Molecular Formula | C14H19ClN6OS |
| Molecular Weight | 354.87 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-[1-[2-(dimethylamino)ethyl]tetrazol-5-yl]sulfanylacetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CSc1nnnn1CCN(C)C |
| InChI | InChI=1S/C14H19ClN6OS/c1-10-11(15)5-4-6-12(10)16-13(22)9-23-14-17-18-19-21(14)8-7-20(2)3/h4-6H,7-9H2,1-3H3,(H,16,22) |
| InChIKey | WXGBMZAYNFTUOA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.87 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |