C15H20ClN3O2 — CID 106346422
2-[2-(2-chloroethyl)-4-methoxybenzimidazol-1-yl]-3-methylbutanamide (PubChem CID 106346422) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 2-[2-(2-chloroethyl)-4-methoxybenzimidazol-1-yl]-3-methylbutanamide.
| Compound Name | 2-[2-(2-chloroethyl)-4-methoxybenzimidazol-1-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 106346422 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-[2-(2-chloroethyl)-4-methoxybenzimidazol-1-yl]-3-methylbutanamide |
| SMILES | COc1cccc2c1nc(CCCl)n2C(C(N)=O)C(C)C |
| InChI | InChI=1S/C15H20ClN3O2/c1-9(2)14(15(17)20)19-10-5-4-6-11(21-3)13(10)18-12(19)7-8-16/h4-6,9,14H,7-8H2,1-3H3,(H2,17,20) |
| InChIKey | VKHHAZUXSPHTGI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|