C15H20Cl2N2O — CID 104838313
4-chloro-2-(2-chloroethyl)-1-(1-methoxy-3-methylbutan-2-yl)benzimidazole (PubChem CID 104838313) has the molecular formula C15H20Cl2N2O and a molecular weight of 315.24 g/mol. Its IUPAC name is 4-chloro-2-(2-chloroethyl)-1-(1-methoxy-3-methylbutan-2-yl)benzimidazole.
| Compound Name | 4-chloro-2-(2-chloroethyl)-1-(1-methoxy-3-methylbutan-2-yl)benzimidazole |
|---|---|
| PubChem CID | 104838313 |
| Molecular Formula | C15H20Cl2N2O |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-chloro-2-(2-chloroethyl)-1-(1-methoxy-3-methylbutan-2-yl)benzimidazole |
| SMILES | COCC(C(C)C)n1c(CCCl)nc2c(Cl)cccc21 |
| InChI | InChI=1S/C15H20Cl2N2O/c1-10(2)13(9-20-3)19-12-6-4-5-11(17)15(12)18-14(19)7-8-16/h4-6,10,13H,7-9H2,1-3H3 |
| InChIKey | OMIQIQQQUPRBBG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|