C14H30N2Si — CID 10634734
N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine (PubChem CID 10634734) has the molecular formula C14H30N2Si and a molecular weight of 254.49 g/mol. Its IUPAC name is N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine.
| Compound Name | N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine |
|---|---|
| PubChem CID | 10634734 |
| Molecular Formula | C14H30N2Si |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine |
| SMILES | C[C@H]1CC[C@H]([Si](C)(C)C)N(/C=N/C(C)(C)C)C1 |
| InChI | InChI=1S/C14H30N2Si/c1-12-8-9-13(17(5,6)7)16(10-12)11-15-14(2,3)4/h11-13H,8-10H2,1-7H3/b15-11+/t12-,13-/m0/s1 |
| InChIKey | VJGRDNWJRSIXQY-RFLGGOROSA-N |
| XLogP | 3.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|