About N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine
N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine (PubChem CID 10634734) has the molecular formula C14H30N2Si
and a molecular weight of 254.49 g/mol. Its IUPAC name is N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine.
Molecular Properties
| Compound Name | N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine |
| PubChem CID | 10634734 |
| Molecular Formula | C14H30N2Si |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine |
| SMILES | C[C@H]1CC[C@H]([Si](C)(C)C)N(/C=N/C(C)(C)C)C1 |
| InChI | InChI=1S/C14H30N2Si/c1-12-8-9-13(17(5,6)7)16(10-12)11-15-14(2,3)4/h11-13H,8-10H2,1-7H3/b15-11+/t12-,13-/m0/s1 |
| InChIKey | VJGRDNWJRSIXQY-RFLGGOROSA-N |
| XLogP | 3.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine?
The IUPAC name of N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine (CID 10634734) is N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine.
What is the SMILES notation for N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine?
The canonical SMILES for N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine is C[C@H]1CC[C@H]([Si](C)(C)C)N(/C=N/C(C)(C)C)C1.
What is the InChIKey of N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine?
The InChIKey is VJGRDNWJRSIXQY-RFLGGOROSA-N. The full InChI is InChI=1S/C14H30N2Si/c1-12-8-9-13(17(5,6)7)16(10-12)11-15-14(2,3)4/h11-13H,8-10H2,1-7H3/b15-11+/t12-,13-/m0/s1.
What are the key properties of N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine?
N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine has a molecular weight of 254.49 g/mol, XLogP of 3.79, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1-[(2S,5S)-5-methyl-2-trimethylsilylpiperidin-1-yl]methanimine is sourced from PubChem (CID 10634734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).