C7H14NO- — CID 163437717
2,5-dimethyl-1-oxidopiperidine (PubChem CID 163437717) has the molecular formula C7H14NO- and a molecular weight of 128.19 g/mol. Its IUPAC name is 2,5-dimethyl-1-oxidopiperidine.
| Compound Name | 2,5-dimethyl-1-oxidopiperidine |
|---|---|
| PubChem CID | 163437717 |
| Molecular Formula | C7H14NO- |
| Molecular Weight | 128.19 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | 2,5-dimethyl-1-oxidopiperidine |
| SMILES | CC1CCC(C)N([O-])C1 |
| InChI | InChI=1S/C7H14NO/c1-6-3-4-7(2)8(9)5-6/h6-7H,3-5H2,1-2H3/q-1 |
| InChIKey | PEKHCJGBJKAVHV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |