C14H21NO5S — CID 106348589
3-[(1-hydroxy-4-methylpentan-3-yl)sulfamoylmethyl]benzoic acid (PubChem CID 106348589) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is 3-[(1-hydroxy-4-methylpentan-3-yl)sulfamoylmethyl]benzoic acid.
| Compound Name | 3-[(1-hydroxy-4-methylpentan-3-yl)sulfamoylmethyl]benzoic acid |
|---|---|
| PubChem CID | 106348589 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 3-[(1-hydroxy-4-methylpentan-3-yl)sulfamoylmethyl]benzoic acid |
| SMILES | CC(C)C(CCO)NS(=O)(=O)Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C14H21NO5S/c1-10(2)13(6-7-16)15-21(19,20)9-11-4-3-5-12(8-11)14(17)18/h3-5,8,10,13,15-16H,6-7,9H2,1-2H3,(H,17,18) |
| InChIKey | ZEPMVYFWOYSOSN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |