C12H15NO4S — CID 113480815
3-(but-3-en-2-ylsulfamoylmethyl)benzoic acid (PubChem CID 113480815) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is 3-(but-3-en-2-ylsulfamoylmethyl)benzoic acid.
| Compound Name | 3-(but-3-en-2-ylsulfamoylmethyl)benzoic acid |
|---|---|
| PubChem CID | 113480815 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 3-(but-3-en-2-ylsulfamoylmethyl)benzoic acid |
| SMILES | C=CC(C)NS(=O)(=O)Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C12H15NO4S/c1-3-9(2)13-18(16,17)8-10-5-4-6-11(7-10)12(14)15/h3-7,9,13H,1,8H2,2H3,(H,14,15) |
| InChIKey | SSELLEMWMHUIQL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|