C12H25NO2S — CID 106349010
4,4-dimethyl-3-[(1-oxothian-4-yl)amino]pentan-1-ol (PubChem CID 106349010) has the molecular formula C12H25NO2S and a molecular weight of 247.40 g/mol. Its IUPAC name is 4,4-dimethyl-3-[(1-oxothian-4-yl)amino]pentan-1-ol.
| Compound Name | 4,4-dimethyl-3-[(1-oxothian-4-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 106349010 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 4,4-dimethyl-3-[(1-oxothian-4-yl)amino]pentan-1-ol |
| SMILES | CC(C)(C)C(CCO)NC1CCS(=O)CC1 |
| InChI | InChI=1S/C12H25NO2S/c1-12(2,3)11(4-7-14)13-10-5-8-16(15)9-6-10/h10-11,13-14H,4-9H2,1-3H3 |
| InChIKey | BQNXUYVREZURNQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |