C10H23NO2 — CID 106349684
3-[[(2S)-2-hydroxypropyl]amino]-4,4-dimethylpentan-1-ol (PubChem CID 106349684) has the molecular formula C10H23NO2 and a molecular weight of 189.30 g/mol. Its IUPAC name is 3-[[(2S)-2-hydroxypropyl]amino]-4,4-dimethylpentan-1-ol.
| Compound Name | 3-[[(2S)-2-hydroxypropyl]amino]-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 106349684 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | 3-[[(2S)-2-hydroxypropyl]amino]-4,4-dimethylpentan-1-ol |
| SMILES | C[C@H](O)CNC(CCO)C(C)(C)C |
| InChI | InChI=1S/C10H23NO2/c1-8(13)7-11-9(5-6-12)10(2,3)4/h8-9,11-13H,5-7H2,1-4H3/t8-,9?/m0/s1 |
| InChIKey | DPUFTTOUJODWAG-IENPIDJESA-N |
| XLogP | 0.75 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |