C12H27NO3S — CID 113434724
4,4-dimethyl-3-(2-propan-2-ylsulfonylethylamino)pentan-1-ol (PubChem CID 113434724) has the molecular formula C12H27NO3S and a molecular weight of 265.42 g/mol. Its IUPAC name is 4,4-dimethyl-3-(2-propan-2-ylsulfonylethylamino)pentan-1-ol.
| Compound Name | 4,4-dimethyl-3-(2-propan-2-ylsulfonylethylamino)pentan-1-ol |
|---|---|
| PubChem CID | 113434724 |
| Molecular Formula | C12H27NO3S |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 4,4-dimethyl-3-(2-propan-2-ylsulfonylethylamino)pentan-1-ol |
| SMILES | CC(C)S(=O)(=O)CCNC(CCO)C(C)(C)C |
| InChI | InChI=1S/C12H27NO3S/c1-10(2)17(15,16)9-7-13-11(6-8-14)12(3,4)5/h10-11,13-14H,6-9H2,1-5H3 |
| InChIKey | SNVVBASILBTOSW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |