C10H20F3NO2 — CID 107470442
4,4-dimethyl-3-[2-(trifluoromethoxy)ethylamino]pentan-1-ol (PubChem CID 107470442) has the molecular formula C10H20F3NO2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 4,4-dimethyl-3-[2-(trifluoromethoxy)ethylamino]pentan-1-ol.
| Compound Name | 4,4-dimethyl-3-[2-(trifluoromethoxy)ethylamino]pentan-1-ol |
|---|---|
| PubChem CID | 107470442 |
| Molecular Formula | C10H20F3NO2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 4,4-dimethyl-3-[2-(trifluoromethoxy)ethylamino]pentan-1-ol |
| SMILES | CC(C)(C)C(CCO)NCCOC(F)(F)F |
| InChI | InChI=1S/C10H20F3NO2/c1-9(2,3)8(4-6-15)14-5-7-16-10(11,12)13/h8,14-15H,4-7H2,1-3H3 |
| InChIKey | GCOWPXFLAZZRIO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|