C14H30ClNO3 — CID 106354187
1-chloro-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-4,4-dimethylpentan-3-amine (PubChem CID 106354187) has the molecular formula C14H30ClNO3 and a molecular weight of 295.85 g/mol. Its IUPAC name is 1-chloro-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-4,4-dimethylpentan-3-amine.
| Compound Name | 1-chloro-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-4,4-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 106354187 |
| Molecular Formula | C14H30ClNO3 |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-chloro-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-4,4-dimethylpentan-3-amine |
| SMILES | COCCOCCOCCNC(CCCl)C(C)(C)C |
| InChI | InChI=1S/C14H30ClNO3/c1-14(2,3)13(5-6-15)16-7-8-18-11-12-19-10-9-17-4/h13,16H,5-12H2,1-4H3 |
| InChIKey | DEEQLQHXMZLOGN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|