C11H24ClNO3S — CID 106356510
N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methoxypropane-1-sulfonamide (PubChem CID 106356510) has the molecular formula C11H24ClNO3S and a molecular weight of 285.84 g/mol. Its IUPAC name is N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methoxypropane-1-sulfonamide.
| Compound Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methoxypropane-1-sulfonamide |
|---|---|
| PubChem CID | 106356510 |
| Molecular Formula | C11H24ClNO3S |
| Molecular Weight | 285.84 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methoxypropane-1-sulfonamide |
| SMILES | COCCCS(=O)(=O)NC(CCCl)C(C)(C)C |
| InChI | InChI=1S/C11H24ClNO3S/c1-11(2,3)10(6-7-12)13-17(14,15)9-5-8-16-4/h10,13H,5-9H2,1-4H3 |
| InChIKey | SKKNSXJZZYOVAK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.84 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|