C10H24N2O2 — CID 106345341
2-N-[2-(2-methoxyethoxy)ethyl]-3-methylbutane-1,2-diamine (PubChem CID 106345341) has the molecular formula C10H24N2O2 and a molecular weight of 204.31 g/mol. Its IUPAC name is 2-N-[2-(2-methoxyethoxy)ethyl]-3-methylbutane-1,2-diamine.
| Compound Name | 2-N-[2-(2-methoxyethoxy)ethyl]-3-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 106345341 |
| Molecular Formula | C10H24N2O2 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.18 |
| IUPAC Name | 2-N-[2-(2-methoxyethoxy)ethyl]-3-methylbutane-1,2-diamine |
| SMILES | COCCOCCNC(CN)C(C)C |
| InChI | InChI=1S/C10H24N2O2/c1-9(2)10(8-11)12-4-5-14-7-6-13-3/h9-10,12H,4-8,11H2,1-3H3 |
| InChIKey | DBKCDVUOILMFPO-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|