C10H21F2NO2 — CID 102978065
N-[2-(2,2-difluoroethoxy)ethyl]-1-methoxy-3-methylbutan-2-amine (PubChem CID 102978065) has the molecular formula C10H21F2NO2 and a molecular weight of 225.28 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-1-methoxy-3-methylbutan-2-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-1-methoxy-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 102978065 |
| Molecular Formula | C10H21F2NO2 |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-1-methoxy-3-methylbutan-2-amine |
| SMILES | COCC(NCCOCC(F)F)C(C)C |
| InChI | InChI=1S/C10H21F2NO2/c1-8(2)9(6-14-3)13-4-5-15-7-10(11)12/h8-10,13H,4-7H2,1-3H3 |
| InChIKey | KNOQIVMERBHNDM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|