C22H48N2O2 — CID 89076193
N,N'-bis(1-butoxy-3-methylbutan-2-yl)butane-1,4-diamine (PubChem CID 89076193) has the molecular formula C22H48N2O2 and a molecular weight of 372.64 g/mol. Its IUPAC name is N,N'-bis(1-butoxy-3-methylbutan-2-yl)butane-1,4-diamine.
| Compound Name | N,N'-bis(1-butoxy-3-methylbutan-2-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 89076193 |
| Molecular Formula | C22H48N2O2 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 372.37 |
| IUPAC Name | N,N'-bis(1-butoxy-3-methylbutan-2-yl)butane-1,4-diamine |
| SMILES | CCCCOCC(NCCCCNC(COCCCC)C(C)C)C(C)C |
| InChI | InChI=1S/C22H48N2O2/c1-7-9-15-25-17-21(19(3)4)23-13-11-12-14-24-22(20(5)6)18-26-16-10-8-2/h19-24H,7-18H2,1-6H3 |
| InChIKey | ZBNACFOFJJCOIB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|