C13H27NO3 — CID 106353241
N-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-propoxypropanamide (PubChem CID 106353241) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is N-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-propoxypropanamide.
| Compound Name | N-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-propoxypropanamide |
|---|---|
| PubChem CID | 106353241 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | N-(1-hydroxy-4,4-dimethylpentan-3-yl)-3-propoxypropanamide |
| SMILES | CCCOCCC(=O)NC(CCO)C(C)(C)C |
| InChI | InChI=1S/C13H27NO3/c1-5-9-17-10-7-12(16)14-11(6-8-15)13(2,3)4/h11,15H,5-10H2,1-4H3,(H,14,16) |
| InChIKey | ANFXBLBGXUNMSD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|