C13H27ClN2O2S — CID 106356586
N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methylpiperidine-1-sulfonamide (PubChem CID 106356586) has the molecular formula C13H27ClN2O2S and a molecular weight of 310.89 g/mol. Its IUPAC name is N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methylpiperidine-1-sulfonamide.
| Compound Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106356586 |
| Molecular Formula | C13H27ClN2O2S |
| Molecular Weight | 310.89 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-3-methylpiperidine-1-sulfonamide |
| SMILES | CC1CCCN(S(=O)(=O)NC(CCCl)C(C)(C)C)C1 |
| InChI | InChI=1S/C13H27ClN2O2S/c1-11-6-5-9-16(10-11)19(17,18)15-12(7-8-14)13(2,3)4/h11-12,15H,5-10H2,1-4H3 |
| InChIKey | WQVRQEURYAOFPL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.89 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|