C11H23BrN2O2S — CID 114293836
N-(1-bromo-2-methylbutan-2-yl)-3-methylpiperidine-1-sulfonamide (PubChem CID 114293836) has the molecular formula C11H23BrN2O2S and a molecular weight of 327.29 g/mol. Its IUPAC name is N-(1-bromo-2-methylbutan-2-yl)-3-methylpiperidine-1-sulfonamide.
| Compound Name | N-(1-bromo-2-methylbutan-2-yl)-3-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 114293836 |
| Molecular Formula | C11H23BrN2O2S |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | N-(1-bromo-2-methylbutan-2-yl)-3-methylpiperidine-1-sulfonamide |
| SMILES | CCC(C)(CBr)NS(=O)(=O)N1CCCC(C)C1 |
| InChI | InChI=1S/C11H23BrN2O2S/c1-4-11(3,9-12)13-17(15,16)14-7-5-6-10(2)8-14/h10,13H,4-9H2,1-3H3 |
| InChIKey | VWMWPMLDLJNPDR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|