C11H20BrNO2 — CID 106359886
2-bromo-N-[2-(hydroxymethyl)cyclohexyl]butanamide (PubChem CID 106359886) has the molecular formula C11H20BrNO2 and a molecular weight of 278.19 g/mol. Its IUPAC name is 2-bromo-N-[2-(hydroxymethyl)cyclohexyl]butanamide.
| Compound Name | 2-bromo-N-[2-(hydroxymethyl)cyclohexyl]butanamide |
|---|---|
| PubChem CID | 106359886 |
| Molecular Formula | C11H20BrNO2 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-bromo-N-[2-(hydroxymethyl)cyclohexyl]butanamide |
| SMILES | CCC(Br)C(=O)NC1CCCCC1CO |
| InChI | InChI=1S/C11H20BrNO2/c1-2-9(12)11(15)13-10-6-4-3-5-8(10)7-14/h8-10,14H,2-7H2,1H3,(H,13,15) |
| InChIKey | ABESPICZHOLLIK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|