C16H25FN2O2 — CID 106360364
[2-[[2-amino-1-(3-fluoro-4-methoxyphenyl)ethyl]amino]cyclohexyl]methanol (PubChem CID 106360364) has the molecular formula C16H25FN2O2 and a molecular weight of 296.39 g/mol. Its IUPAC name is [2-[[2-amino-1-(3-fluoro-4-methoxyphenyl)ethyl]amino]cyclohexyl]methanol.
| Compound Name | [2-[[2-amino-1-(3-fluoro-4-methoxyphenyl)ethyl]amino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 106360364 |
| Molecular Formula | C16H25FN2O2 |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | [2-[[2-amino-1-(3-fluoro-4-methoxyphenyl)ethyl]amino]cyclohexyl]methanol |
| SMILES | COc1ccc(C(CN)NC2CCCCC2CO)cc1F |
| InChI | InChI=1S/C16H25FN2O2/c1-21-16-7-6-11(8-13(16)17)15(9-18)19-14-5-3-2-4-12(14)10-20/h6-8,12,14-15,19-20H,2-5,9-10,18H2,1H3 |
| InChIKey | MJYFKFQRFPYDSQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |