C16H25ClN2O2 — CID 106360404
[2-[[2-amino-1-(2-chloro-6-methoxyphenyl)ethyl]amino]cyclohexyl]methanol (PubChem CID 106360404) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is [2-[[2-amino-1-(2-chloro-6-methoxyphenyl)ethyl]amino]cyclohexyl]methanol.
| Compound Name | [2-[[2-amino-1-(2-chloro-6-methoxyphenyl)ethyl]amino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 106360404 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | [2-[[2-amino-1-(2-chloro-6-methoxyphenyl)ethyl]amino]cyclohexyl]methanol |
| SMILES | COc1cccc(Cl)c1C(CN)NC1CCCCC1CO |
| InChI | InChI=1S/C16H25ClN2O2/c1-21-15-8-4-6-12(17)16(15)14(9-18)19-13-7-3-2-5-11(13)10-20/h4,6,8,11,13-14,19-20H,2-3,5,7,9-10,18H2,1H3 |
| InChIKey | JJMOIWGBWMPYQX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |