C9H15Cl2NO — CID 106360754
[2-(2,3-dichloroprop-2-enylamino)cyclopentyl]methanol (PubChem CID 106360754) has the molecular formula C9H15Cl2NO and a molecular weight of 224.13 g/mol. Its IUPAC name is [2-(2,3-dichloroprop-2-enylamino)cyclopentyl]methanol.
| Compound Name | [2-(2,3-dichloroprop-2-enylamino)cyclopentyl]methanol |
|---|---|
| PubChem CID | 106360754 |
| Molecular Formula | C9H15Cl2NO |
| Molecular Weight | 224.13 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | [2-(2,3-dichloroprop-2-enylamino)cyclopentyl]methanol |
| SMILES | OCC1CCCC1NCC(Cl)=CCl |
| InChI | InChI=1S/C9H15Cl2NO/c10-4-8(11)5-12-9-3-1-2-7(9)6-13/h4,7,9,12-13H,1-3,5-6H2 |
| InChIKey | PEVCKRSKMUOUFU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.13 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |