C10H18ClNO — CID 106438361
[2-[(3-chloro-2-methylprop-2-enyl)amino]cyclopentyl]methanol (PubChem CID 106438361) has the molecular formula C10H18ClNO and a molecular weight of 203.71 g/mol. Its IUPAC name is [2-[(3-chloro-2-methylprop-2-enyl)amino]cyclopentyl]methanol.
| Compound Name | [2-[(3-chloro-2-methylprop-2-enyl)amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 106438361 |
| Molecular Formula | C10H18ClNO |
| Molecular Weight | 203.71 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | [2-[(3-chloro-2-methylprop-2-enyl)amino]cyclopentyl]methanol |
| SMILES | CC(=CCl)CNC1CCCC1CO |
| InChI | InChI=1S/C10H18ClNO/c1-8(5-11)6-12-10-4-2-3-9(10)7-13/h5,9-10,12-13H,2-4,6-7H2,1H3 |
| InChIKey | KTTHPTBYTXTEMS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.71 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |