C11H20ClNO — CID 106437857
[2-[[(3-chloro-2-methylprop-2-enyl)amino]methyl]cyclopentyl]methanol (PubChem CID 106437857) has the molecular formula C11H20ClNO and a molecular weight of 217.74 g/mol. Its IUPAC name is [2-[[(3-chloro-2-methylprop-2-enyl)amino]methyl]cyclopentyl]methanol.
| Compound Name | [2-[[(3-chloro-2-methylprop-2-enyl)amino]methyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 106437857 |
| Molecular Formula | C11H20ClNO |
| Molecular Weight | 217.74 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | [2-[[(3-chloro-2-methylprop-2-enyl)amino]methyl]cyclopentyl]methanol |
| SMILES | CC(=CCl)CNCC1CCCC1CO |
| InChI | InChI=1S/C11H20ClNO/c1-9(5-12)6-13-7-10-3-2-4-11(10)8-14/h5,10-11,13-14H,2-4,6-8H2,1H3 |
| InChIKey | VIWLNRBAEDZOIS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.74 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |