C16H24N2O2 — CID 106361498
2-(2-aminoethyl)-N-[2-(hydroxymethyl)cyclohexyl]benzamide (PubChem CID 106361498) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-[2-(hydroxymethyl)cyclohexyl]benzamide.
| Compound Name | 2-(2-aminoethyl)-N-[2-(hydroxymethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 106361498 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 2-(2-aminoethyl)-N-[2-(hydroxymethyl)cyclohexyl]benzamide |
| SMILES | NCCc1ccccc1C(=O)NC1CCCCC1CO |
| InChI | InChI=1S/C16H24N2O2/c17-10-9-12-5-1-3-7-14(12)16(20)18-15-8-4-2-6-13(15)11-19/h1,3,5,7,13,15,19H,2,4,6,8-11,17H2,(H,18,20) |
| InChIKey | IQOKUWPAEBOMDY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |