C17H23NO3 — CID 106364464
N-[2-(hydroxymethyl)cyclohexyl]-2-prop-2-enoxybenzamide (PubChem CID 106364464) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[2-(hydroxymethyl)cyclohexyl]-2-prop-2-enoxybenzamide.
| Compound Name | N-[2-(hydroxymethyl)cyclohexyl]-2-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 106364464 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-[2-(hydroxymethyl)cyclohexyl]-2-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccccc1C(=O)NC1CCCCC1CO |
| InChI | InChI=1S/C17H23NO3/c1-2-11-21-16-10-6-4-8-14(16)17(20)18-15-9-5-3-7-13(15)12-19/h2,4,6,8,10,13,15,19H,1,3,5,7,9,11-12H2,(H,18,20) |
| InChIKey | KXFYMXUYKNGRLQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|