C16H21NO3 — CID 104957272
N-[(1S,2S)-2-hydroxycyclohexyl]-2-prop-2-enoxybenzamide (PubChem CID 104957272) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-2-prop-2-enoxybenzamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 104957272 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccccc1C(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C16H21NO3/c1-2-11-20-15-10-6-3-7-12(15)16(19)17-13-8-4-5-9-14(13)18/h2-3,6-7,10,13-14,18H,1,4-5,8-9,11H2,(H,17,19)/t13-,14-/m0/s1 |
| InChIKey | DWXDYCGILFNNNN-KBPBESRZSA-N |
| XLogP | 2.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|