C15H21N3O4S — CID 126831789
2-prop-2-enoxy-N-(1-sulfamoylpiperidin-4-yl)benzamide (PubChem CID 126831789) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is 2-prop-2-enoxy-N-(1-sulfamoylpiperidin-4-yl)benzamide.
| Compound Name | 2-prop-2-enoxy-N-(1-sulfamoylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 126831789 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-prop-2-enoxy-N-(1-sulfamoylpiperidin-4-yl)benzamide |
| SMILES | C=CCOc1ccccc1C(=O)NC1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C15H21N3O4S/c1-2-11-22-14-6-4-3-5-13(14)15(19)17-12-7-9-18(10-8-12)23(16,20)21/h2-6,12H,1,7-11H2,(H,17,19)(H2,16,20,21) |
| InChIKey | JVOSSGRBTZGYOR-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|