C15H21N3O3 — CID 119604933
N-[2-(aminomethyl)cyclopentyl]-2-(2-amino-2-oxoethoxy)benzamide (PubChem CID 119604933) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-2-(2-amino-2-oxoethoxy)benzamide.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-2-(2-amino-2-oxoethoxy)benzamide |
|---|---|
| PubChem CID | 119604933 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-2-(2-amino-2-oxoethoxy)benzamide |
| SMILES | NCC1CCCC1NC(=O)c1ccccc1OCC(N)=O |
| InChI | InChI=1S/C15H21N3O3/c16-8-10-4-3-6-12(10)18-15(20)11-5-1-2-7-13(11)21-9-14(17)19/h1-2,5,7,10,12H,3-4,6,8-9,16H2,(H2,17,19)(H,18,20) |
| InChIKey | QGGWTWXAVYWYQK-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |