C15H30N2O2 — CID 106361550
3-amino-N-[2-(hydroxymethyl)cyclohexyl]-5,5-dimethylhexanamide (PubChem CID 106361550) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 3-amino-N-[2-(hydroxymethyl)cyclohexyl]-5,5-dimethylhexanamide.
| Compound Name | 3-amino-N-[2-(hydroxymethyl)cyclohexyl]-5,5-dimethylhexanamide |
|---|---|
| PubChem CID | 106361550 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 3-amino-N-[2-(hydroxymethyl)cyclohexyl]-5,5-dimethylhexanamide |
| SMILES | CC(C)(C)CC(N)CC(=O)NC1CCCCC1CO |
| InChI | InChI=1S/C15H30N2O2/c1-15(2,3)9-12(16)8-14(19)17-13-7-5-4-6-11(13)10-18/h11-13,18H,4-10,16H2,1-3H3,(H,17,19) |
| InChIKey | JHTISBWGGSFWIG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |