C10H16F3NO2 — CID 103816678
3,3,3-trifluoro-N-[2-(hydroxymethyl)cyclohexyl]propanamide (PubChem CID 103816678) has the molecular formula C10H16F3NO2 and a molecular weight of 239.24 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[2-(hydroxymethyl)cyclohexyl]propanamide.
| Compound Name | 3,3,3-trifluoro-N-[2-(hydroxymethyl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 103816678 |
| Molecular Formula | C10H16F3NO2 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3,3,3-trifluoro-N-[2-(hydroxymethyl)cyclohexyl]propanamide |
| SMILES | O=C(CC(F)(F)F)NC1CCCCC1CO |
| InChI | InChI=1S/C10H16F3NO2/c11-10(12,13)5-9(16)14-8-4-2-1-3-7(8)6-15/h7-8,15H,1-6H2,(H,14,16) |
| InChIKey | OEFGXYPDJCMSKK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |