C9H16F3NO — CID 99610237
[(1R,2R)-2-(2,2,2-trifluoroethylamino)cyclohexyl]methanol (PubChem CID 99610237) has the molecular formula C9H16F3NO and a molecular weight of 211.23 g/mol. Its IUPAC name is [(1R,2R)-2-(2,2,2-trifluoroethylamino)cyclohexyl]methanol.
| Compound Name | [(1R,2R)-2-(2,2,2-trifluoroethylamino)cyclohexyl]methanol |
|---|---|
| PubChem CID | 99610237 |
| Molecular Formula | C9H16F3NO |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | [(1R,2R)-2-(2,2,2-trifluoroethylamino)cyclohexyl]methanol |
| SMILES | OC[C@@H]1CCCC[C@H]1NCC(F)(F)F |
| InChI | InChI=1S/C9H16F3NO/c10-9(11,12)6-13-8-4-2-1-3-7(8)5-14/h7-8,13-14H,1-6H2/t7-,8+/m0/s1 |
| InChIKey | CZJKBMADPQLTJX-JGVFFNPUSA-N |
| XLogP | 1.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |